C13H25NO2S — CID 117271412
4-[2-(2-ethylpyrrolidin-2-yl)ethyl]thiane 1,1-dioxide (PubChem CID 117271412) has the molecular formula C13H25NO2S and a molecular weight of 259.41 g/mol. Its IUPAC name is 4-[2-(2-ethylpyrrolidin-2-yl)ethyl]thiane 1,1-dioxide.
| Compound Name | 4-[2-(2-ethylpyrrolidin-2-yl)ethyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 117271412 |
| Molecular Formula | C13H25NO2S |
| Molecular Weight | 259.41 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 4-[2-(2-ethylpyrrolidin-2-yl)ethyl]thiane 1,1-dioxide |
| SMILES | CCC1(CCC2CCS(=O)(=O)CC2)CCCN1 |
| InChI | InChI=1S/C13H25NO2S/c1-2-13(7-3-9-14-13)8-4-12-5-10-17(15,16)11-6-12/h12,14H,2-11H2,1H3 |
| InChIKey | HSEFUTUKMZQXLW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |