C10H17F3O — CID 130596537
(2R)-1,1,1-trifluoro-3-(4-methylcyclohexyl)propan-2-ol (PubChem CID 130596537) has the molecular formula C10H17F3O and a molecular weight of 210.24 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-3-(4-methylcyclohexyl)propan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-3-(4-methylcyclohexyl)propan-2-ol |
|---|---|
| PubChem CID | 130596537 |
| Molecular Formula | C10H17F3O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | (2R)-1,1,1-trifluoro-3-(4-methylcyclohexyl)propan-2-ol |
| SMILES | CC1CCC(C[C@@H](O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H17F3O/c1-7-2-4-8(5-3-7)6-9(14)10(11,12)13/h7-9,14H,2-6H2,1H3/t7?,8?,9-/m1/s1 |
| InChIKey | WYPICPDYXHDJQV-AMDVSUOASA-N |
| XLogP | 3.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |