C9H14F3NO3S — CID 163828197
N-[2-(1,1-dioxothian-4-yl)ethyl]-2,2,2-trifluoroacetamide (PubChem CID 163828197) has the molecular formula C9H14F3NO3S and a molecular weight of 273.28 g/mol. Its IUPAC name is N-[2-(1,1-dioxothian-4-yl)ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-(1,1-dioxothian-4-yl)ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 163828197 |
| Molecular Formula | C9H14F3NO3S |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | N-[2-(1,1-dioxothian-4-yl)ethyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCCC1CCS(=O)(=O)CC1)C(F)(F)F |
| InChI | InChI=1S/C9H14F3NO3S/c10-9(11,12)8(14)13-4-1-7-2-5-17(15,16)6-3-7/h7H,1-6H2,(H,13,14) |
| InChIKey | GXLCRLYWKXLHDY-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |