C6H6F5IO — CID 86631045
5,5,6,6,6-pentafluoro-3-iodohex-3-en-2-ol (PubChem CID 86631045) has the molecular formula C6H6F5IO and a molecular weight of 316.01 g/mol. Its IUPAC name is 5,5,6,6,6-pentafluoro-3-iodohex-3-en-2-ol.
| Compound Name | 5,5,6,6,6-pentafluoro-3-iodohex-3-en-2-ol |
|---|---|
| PubChem CID | 86631045 |
| Molecular Formula | C6H6F5IO |
| Molecular Weight | 316.01 g/mol |
| Exact Mass | 315.94 |
| IUPAC Name | 5,5,6,6,6-pentafluoro-3-iodohex-3-en-2-ol |
| SMILES | CC(O)C(I)=CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H6F5IO/c1-3(13)4(12)2-5(7,8)6(9,10)11/h2-3,13H,1H3 |
| InChIKey | KNANQQXOGPBDMS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.01 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|