C8H12F3IO — CID 101139199
(Z)-6,6,6-trifluoro-5-iodo-2,3-dimethylhex-4-en-3-ol (PubChem CID 101139199) has the molecular formula C8H12F3IO and a molecular weight of 308.08 g/mol. Its IUPAC name is (Z)-6,6,6-trifluoro-5-iodo-2,3-dimethylhex-4-en-3-ol.
| Compound Name | (Z)-6,6,6-trifluoro-5-iodo-2,3-dimethylhex-4-en-3-ol |
|---|---|
| PubChem CID | 101139199 |
| Molecular Formula | C8H12F3IO |
| Molecular Weight | 308.08 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | (Z)-6,6,6-trifluoro-5-iodo-2,3-dimethylhex-4-en-3-ol |
| SMILES | CC(C)C(C)(O)/C=C(\I)C(F)(F)F |
| InChI | InChI=1S/C8H12F3IO/c1-5(2)7(3,13)4-6(12)8(9,10)11/h4-5,13H,1-3H3/b6-4- |
| InChIKey | NMVLVIJJCMCDED-XQRVVYSFSA-N |
| XLogP | 3.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.08 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|