C7H8F5IO — CID 86631046
6,6,7,7,7-pentafluoro-4-iodohept-4-en-3-ol (PubChem CID 86631046) has the molecular formula C7H8F5IO and a molecular weight of 330.03 g/mol. Its IUPAC name is 6,6,7,7,7-pentafluoro-4-iodohept-4-en-3-ol.
| Compound Name | 6,6,7,7,7-pentafluoro-4-iodohept-4-en-3-ol |
|---|---|
| PubChem CID | 86631046 |
| Molecular Formula | C7H8F5IO |
| Molecular Weight | 330.03 g/mol |
| Exact Mass | 329.95 |
| IUPAC Name | 6,6,7,7,7-pentafluoro-4-iodohept-4-en-3-ol |
| SMILES | CCC(O)C(I)=CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H8F5IO/c1-2-5(14)4(13)3-6(8,9)7(10,11)12/h3,5,14H,2H2,1H3 |
| InChIKey | RQMYMANNTGNORX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.03 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|