C5H6F6O2 — CID 135017833
(4S)-1,1,1,5,5,5-hexafluoropentane-2,4-diol (PubChem CID 135017833) has the molecular formula C5H6F6O2 and a molecular weight of 212.09 g/mol. Its IUPAC name is (4S)-1,1,1,5,5,5-hexafluoropentane-2,4-diol.
| Compound Name | (4S)-1,1,1,5,5,5-hexafluoropentane-2,4-diol |
|---|---|
| PubChem CID | 135017833 |
| Molecular Formula | C5H6F6O2 |
| Molecular Weight | 212.09 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | (4S)-1,1,1,5,5,5-hexafluoropentane-2,4-diol |
| SMILES | OC(C[C@H](O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H6F6O2/c6-4(7,8)2(12)1-3(13)5(9,10)11/h2-3,12-13H,1H2/t2-,3?/m0/s1 |
| InChIKey | GGJLQYZUNXNIEQ-SCQFTWEKSA-N |
| XLogP | 1.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.09 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |