C10H17F5N2O — CID 165439242
1-[1-(1-amino-3,3,4,4,4-pentafluorobutan-2-yl)pyrrolidin-3-yl]ethanol (PubChem CID 165439242) has the molecular formula C10H17F5N2O and a molecular weight of 276.25 g/mol. Its IUPAC name is 1-[1-(1-amino-3,3,4,4,4-pentafluorobutan-2-yl)pyrrolidin-3-yl]ethanol.
| Compound Name | 1-[1-(1-amino-3,3,4,4,4-pentafluorobutan-2-yl)pyrrolidin-3-yl]ethanol |
|---|---|
| PubChem CID | 165439242 |
| Molecular Formula | C10H17F5N2O |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 1-[1-(1-amino-3,3,4,4,4-pentafluorobutan-2-yl)pyrrolidin-3-yl]ethanol |
| SMILES | CC(O)C1CCN(C(CN)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C10H17F5N2O/c1-6(18)7-2-3-17(5-7)8(4-16)9(11,12)10(13,14)15/h6-8,18H,2-5,16H2,1H3 |
| InChIKey | AUWPWBXOHVLKAH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|