C9H15BrF3NO — CID 112628065
1-[1-(2-bromo-3,3,3-trifluoropropyl)pyrrolidin-3-yl]ethanol (PubChem CID 112628065) has the molecular formula C9H15BrF3NO and a molecular weight of 290.12 g/mol. Its IUPAC name is 1-[1-(2-bromo-3,3,3-trifluoropropyl)pyrrolidin-3-yl]ethanol.
| Compound Name | 1-[1-(2-bromo-3,3,3-trifluoropropyl)pyrrolidin-3-yl]ethanol |
|---|---|
| PubChem CID | 112628065 |
| Molecular Formula | C9H15BrF3NO |
| Molecular Weight | 290.12 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 1-[1-(2-bromo-3,3,3-trifluoropropyl)pyrrolidin-3-yl]ethanol |
| SMILES | CC(O)C1CCN(CC(Br)C(F)(F)F)C1 |
| InChI | InChI=1S/C9H15BrF3NO/c1-6(15)7-2-3-14(4-7)5-8(10)9(11,12)13/h6-8,15H,2-5H2,1H3 |
| InChIKey | BYIIBKYVYXTPFQ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.12 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|