C8H13BrF3NO — CID 64756949
1-(2-bromo-3,3,3-trifluoropropyl)piperidin-3-ol (PubChem CID 64756949) has the molecular formula C8H13BrF3NO and a molecular weight of 276.10 g/mol. Its IUPAC name is 1-(2-bromo-3,3,3-trifluoropropyl)piperidin-3-ol.
| Compound Name | 1-(2-bromo-3,3,3-trifluoropropyl)piperidin-3-ol |
|---|---|
| PubChem CID | 64756949 |
| Molecular Formula | C8H13BrF3NO |
| Molecular Weight | 276.10 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | 1-(2-bromo-3,3,3-trifluoropropyl)piperidin-3-ol |
| SMILES | OC1CCCN(CC(Br)C(F)(F)F)C1 |
| InChI | InChI=1S/C8H13BrF3NO/c9-7(8(10,11)12)5-13-3-1-2-6(14)4-13/h6-7,14H,1-5H2 |
| InChIKey | GEGJZMGCQBXRSG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.10 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|