C8H13BrF3N — CID 124508985
1-[(2R)-2-bromo-3,3,3-trifluoropropyl]piperidine (PubChem CID 124508985) has the molecular formula C8H13BrF3N and a molecular weight of 260.10 g/mol. Its IUPAC name is 1-[(2R)-2-bromo-3,3,3-trifluoropropyl]piperidine.
| Compound Name | 1-[(2R)-2-bromo-3,3,3-trifluoropropyl]piperidine |
|---|---|
| PubChem CID | 124508985 |
| Molecular Formula | C8H13BrF3N |
| Molecular Weight | 260.10 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 1-[(2R)-2-bromo-3,3,3-trifluoropropyl]piperidine |
| SMILES | FC(F)(F)[C@H](Br)CN1CCCCC1 |
| InChI | InChI=1S/C8H13BrF3N/c9-7(8(10,11)12)6-13-4-2-1-3-5-13/h7H,1-6H2/t7-/m1/s1 |
| InChIKey | HUVNSMUEFJOGCP-SSDOTTSWSA-N |
| XLogP | 2.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.10 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|