C7H11BrF3NOS — CID 64758744
4-(2-bromo-3,3,3-trifluoropropyl)-1,4-thiazinane 1-oxide (PubChem CID 64758744) has the molecular formula C7H11BrF3NOS and a molecular weight of 294.14 g/mol. Its IUPAC name is 4-(2-bromo-3,3,3-trifluoropropyl)-1,4-thiazinane 1-oxide.
| Compound Name | 4-(2-bromo-3,3,3-trifluoropropyl)-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 64758744 |
| Molecular Formula | C7H11BrF3NOS |
| Molecular Weight | 294.14 g/mol |
| Exact Mass | 292.97 |
| IUPAC Name | 4-(2-bromo-3,3,3-trifluoropropyl)-1,4-thiazinane 1-oxide |
| SMILES | O=S1CCN(CC(Br)C(F)(F)F)CC1 |
| InChI | InChI=1S/C7H11BrF3NOS/c8-6(7(9,10)11)5-12-1-3-14(13)4-2-12/h6H,1-5H2 |
| InChIKey | KDCGYCPYOATQGC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.14 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|