C9H18BrNOS — CID 65000575
4-[2-(bromomethyl)butyl]-1,4-thiazinane 1-oxide (PubChem CID 65000575) has the molecular formula C9H18BrNOS and a molecular weight of 268.22 g/mol. Its IUPAC name is 4-[2-(bromomethyl)butyl]-1,4-thiazinane 1-oxide.
| Compound Name | 4-[2-(bromomethyl)butyl]-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 65000575 |
| Molecular Formula | C9H18BrNOS |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 4-[2-(bromomethyl)butyl]-1,4-thiazinane 1-oxide |
| SMILES | CCC(CBr)CN1CCS(=O)CC1 |
| InChI | InChI=1S/C9H18BrNOS/c1-2-9(7-10)8-11-3-5-13(12)6-4-11/h9H,2-8H2,1H3 |
| InChIKey | HQPZCLRTBJZURY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|