C12H23N — CID 145001252
1-(2-ethylbutyl)-2,3,6,7-tetrahydroazepine (PubChem CID 145001252) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is 1-(2-ethylbutyl)-2,3,6,7-tetrahydroazepine.
| Compound Name | 1-(2-ethylbutyl)-2,3,6,7-tetrahydroazepine |
|---|---|
| PubChem CID | 145001252 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 1-(2-ethylbutyl)-2,3,6,7-tetrahydroazepine |
| SMILES | CCC(CC)CN1CCC=CCC1 |
| InChI | InChI=1S/C12H23N/c1-3-12(4-2)11-13-9-7-5-6-8-10-13/h5-6,12H,3-4,7-11H2,1-2H3 |
| InChIKey | BNFZARNOERIHKU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|