C12H24N2 — CID 114410673
2-(3,6-dihydro-2H-pyridin-1-ylmethyl)-4-methylpentan-1-amine (PubChem CID 114410673) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is 2-(3,6-dihydro-2H-pyridin-1-ylmethyl)-4-methylpentan-1-amine.
| Compound Name | 2-(3,6-dihydro-2H-pyridin-1-ylmethyl)-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 114410673 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 2-(3,6-dihydro-2H-pyridin-1-ylmethyl)-4-methylpentan-1-amine |
| SMILES | CC(C)CC(CN)CN1CC=CCC1 |
| InChI | InChI=1S/C12H24N2/c1-11(2)8-12(9-13)10-14-6-4-3-5-7-14/h3-4,11-12H,5-10,13H2,1-2H3 |
| InChIKey | OLEWVQBYMQHDJE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|