C11H22N2 — CID 114410564
1-(3,6-dihydro-2H-pyridin-1-yl)hexan-2-amine (PubChem CID 114410564) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 1-(3,6-dihydro-2H-pyridin-1-yl)hexan-2-amine.
| Compound Name | 1-(3,6-dihydro-2H-pyridin-1-yl)hexan-2-amine |
|---|---|
| PubChem CID | 114410564 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 1-(3,6-dihydro-2H-pyridin-1-yl)hexan-2-amine |
| SMILES | CCCCC(N)CN1CC=CCC1 |
| InChI | InChI=1S/C11H22N2/c1-2-3-7-11(12)10-13-8-5-4-6-9-13/h4-5,11H,2-3,6-10,12H2,1H3 |
| InChIKey | QDBKFWCZSFCCCE-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|