C13H26N2 — CID 114410592
6-(3,6-dihydro-2H-pyridin-1-yl)-3-ethylhexan-1-amine (PubChem CID 114410592) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is 6-(3,6-dihydro-2H-pyridin-1-yl)-3-ethylhexan-1-amine.
| Compound Name | 6-(3,6-dihydro-2H-pyridin-1-yl)-3-ethylhexan-1-amine |
|---|---|
| PubChem CID | 114410592 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 6-(3,6-dihydro-2H-pyridin-1-yl)-3-ethylhexan-1-amine |
| SMILES | CCC(CCN)CCCN1CC=CCC1 |
| InChI | InChI=1S/C13H26N2/c1-2-13(8-9-14)7-6-12-15-10-4-3-5-11-15/h3-4,13H,2,5-12,14H2,1H3 |
| InChIKey | QUHCBHOHZUCMON-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|