C9H12BrF3N2 — CID 164658014
1-(2-bromo-3,3,3-trifluoropropyl)piperidine-3-carbonitrile (PubChem CID 164658014) has the molecular formula C9H12BrF3N2 and a molecular weight of 285.11 g/mol. Its IUPAC name is 1-(2-bromo-3,3,3-trifluoropropyl)piperidine-3-carbonitrile.
| Compound Name | 1-(2-bromo-3,3,3-trifluoropropyl)piperidine-3-carbonitrile |
|---|---|
| PubChem CID | 164658014 |
| Molecular Formula | C9H12BrF3N2 |
| Molecular Weight | 285.11 g/mol |
| Exact Mass | 284.01 |
| IUPAC Name | 1-(2-bromo-3,3,3-trifluoropropyl)piperidine-3-carbonitrile |
| SMILES | N#CC1CCCN(CC(Br)C(F)(F)F)C1 |
| InChI | InChI=1S/C9H12BrF3N2/c10-8(9(11,12)13)6-15-3-1-2-7(4-14)5-15/h7-8H,1-3,5-6H2 |
| InChIKey | RLKHIKWZKPAUCV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.11 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|