C11H19BrF3NO — CID 102745273
4-(2-bromo-3,3,3-trifluoropropyl)-2,2,6,6-tetramethylmorpholine (PubChem CID 102745273) has the molecular formula C11H19BrF3NO and a molecular weight of 318.18 g/mol. Its IUPAC name is 4-(2-bromo-3,3,3-trifluoropropyl)-2,2,6,6-tetramethylmorpholine.
| Compound Name | 4-(2-bromo-3,3,3-trifluoropropyl)-2,2,6,6-tetramethylmorpholine |
|---|---|
| PubChem CID | 102745273 |
| Molecular Formula | C11H19BrF3NO |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 4-(2-bromo-3,3,3-trifluoropropyl)-2,2,6,6-tetramethylmorpholine |
| SMILES | CC1(C)CN(CC(Br)C(F)(F)F)CC(C)(C)O1 |
| InChI | InChI=1S/C11H19BrF3NO/c1-9(2)6-16(7-10(3,4)17-9)5-8(12)11(13,14)15/h8H,5-7H2,1-4H3 |
| InChIKey | SDNQPQGXYDSQSK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|