C13H15BrF4N2 — CID 64758736
1-(2-bromo-3,3,3-trifluoropropyl)-4-(4-fluorophenyl)piperazine (PubChem CID 64758736) has the molecular formula C13H15BrF4N2 and a molecular weight of 355.17 g/mol. Its IUPAC name is 1-(2-bromo-3,3,3-trifluoropropyl)-4-(4-fluorophenyl)piperazine.
| Compound Name | 1-(2-bromo-3,3,3-trifluoropropyl)-4-(4-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 64758736 |
| Molecular Formula | C13H15BrF4N2 |
| Molecular Weight | 355.17 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 1-(2-bromo-3,3,3-trifluoropropyl)-4-(4-fluorophenyl)piperazine |
| SMILES | Fc1ccc(N2CCN(CC(Br)C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C13H15BrF4N2/c14-12(13(16,17)18)9-19-5-7-20(8-6-19)11-3-1-10(15)2-4-11/h1-4,12H,5-9H2 |
| InChIKey | DXSINCBSKXOTHW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.17 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|