C16H23FN2O — CID 4083768
1-[4-(4-fluorophenyl)piperazin-1-yl]-3,3-dimethylbutan-2-one (PubChem CID 4083768) has the molecular formula C16H23FN2O and a molecular weight of 278.37 g/mol. Its IUPAC name is 1-[4-(4-fluorophenyl)piperazin-1-yl]-3,3-dimethylbutan-2-one.
| Compound Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 4083768 |
| Molecular Formula | C16H23FN2O |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1-[4-(4-fluorophenyl)piperazin-1-yl]-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)CN1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C16H23FN2O/c1-16(2,3)15(20)12-18-8-10-19(11-9-18)14-6-4-13(17)5-7-14/h4-7H,8-12H2,1-3H3 |
| InChIKey | DYSLBACBXMNNQU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |