C17H23FN2O2 — CID 110709736
1-[4-(4-fluorobenzoyl)piperazin-1-yl]-3,3-dimethylbutan-2-one (PubChem CID 110709736) has the molecular formula C17H23FN2O2 and a molecular weight of 306.38 g/mol. Its IUPAC name is 1-[4-(4-fluorobenzoyl)piperazin-1-yl]-3,3-dimethylbutan-2-one.
| Compound Name | 1-[4-(4-fluorobenzoyl)piperazin-1-yl]-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 110709736 |
| Molecular Formula | C17H23FN2O2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 1-[4-(4-fluorobenzoyl)piperazin-1-yl]-3,3-dimethylbutan-2-one |
| SMILES | CC(C)(C)C(=O)CN1CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H23FN2O2/c1-17(2,3)15(21)12-19-8-10-20(11-9-19)16(22)13-4-6-14(18)7-5-13/h4-7H,8-12H2,1-3H3 |
| InChIKey | PTQFLLOCCSKFTF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |