C18H26N2O3 — CID 110709738
1-[4-(2-methoxybenzoyl)piperazin-1-yl]-3,3-dimethylbutan-2-one (PubChem CID 110709738) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-[4-(2-methoxybenzoyl)piperazin-1-yl]-3,3-dimethylbutan-2-one.
| Compound Name | 1-[4-(2-methoxybenzoyl)piperazin-1-yl]-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 110709738 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 1-[4-(2-methoxybenzoyl)piperazin-1-yl]-3,3-dimethylbutan-2-one |
| SMILES | COc1ccccc1C(=O)N1CCN(CC(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H26N2O3/c1-18(2,3)16(21)13-19-9-11-20(12-10-19)17(22)14-7-5-6-8-15(14)23-4/h5-8H,9-13H2,1-4H3 |
| InChIKey | QSBYFNOSEVRGHU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |