C8H10F7NO3 — CID 44512711
(2R,5R)-2-amino-6,6,7,7,8,8,8-heptafluoro-5-hydroxyoctanoic acid (PubChem CID 44512711) has the molecular formula C8H10F7NO3 and a molecular weight of 301.16 g/mol. Its IUPAC name is (2R,5R)-2-amino-6,6,7,7,8,8,8-heptafluoro-5-hydroxyoctanoic acid.
| Compound Name | (2R,5R)-2-amino-6,6,7,7,8,8,8-heptafluoro-5-hydroxyoctanoic acid |
|---|---|
| PubChem CID | 44512711 |
| Molecular Formula | C8H10F7NO3 |
| Molecular Weight | 301.16 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | (2R,5R)-2-amino-6,6,7,7,8,8,8-heptafluoro-5-hydroxyoctanoic acid |
| SMILES | N[C@H](CC[C@@H](O)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C8H10F7NO3/c9-6(10,7(11,12)8(13,14)15)4(17)2-1-3(16)5(18)19/h3-4,17H,1-2,16H2,(H,18,19)/t3-,4-/m1/s1 |
| InChIKey | OHPMQCHNAWSGGJ-QWWZWVQMSA-N |
| XLogP | 1.37 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.16 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|