C4H5F5O3S — CID 91525496
1,1,1,3,3-pentafluoro-3-methylsulfonylpropan-2-ol (PubChem CID 91525496) has the molecular formula C4H5F5O3S and a molecular weight of 228.14 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluoro-3-methylsulfonylpropan-2-ol.
| Compound Name | 1,1,1,3,3-pentafluoro-3-methylsulfonylpropan-2-ol |
|---|---|
| PubChem CID | 91525496 |
| Molecular Formula | C4H5F5O3S |
| Molecular Weight | 228.14 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | 1,1,1,3,3-pentafluoro-3-methylsulfonylpropan-2-ol |
| SMILES | CS(=O)(=O)C(F)(F)C(O)C(F)(F)F |
| InChI | InChI=1S/C4H5F5O3S/c1-13(11,12)4(8,9)2(10)3(5,6)7/h2,10H,1H3 |
| InChIKey | HJPGUDHPESVIRI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.14 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |