C5H8F6O6S3 — CID 157404640
methane;trifluoro-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonylmethane (PubChem CID 157404640) has the molecular formula C5H8F6O6S3 and a molecular weight of 374.30 g/mol. Its IUPAC name is methane;trifluoro-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonylmethane.
| Compound Name | methane;trifluoro-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonylmethane |
|---|---|
| PubChem CID | 157404640 |
| Molecular Formula | C5H8F6O6S3 |
| Molecular Weight | 374.30 g/mol |
| Exact Mass | 373.94 |
| IUPAC Name | methane;trifluoro-[methylsulfonyl(trifluoromethylsulfonyl)methyl]sulfonylmethane |
| SMILES | C.CS(=O)(=O)C(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C4H4F6O6S3.CH4/c1-17(11,12)2(18(13,14)3(5,6)7)19(15,16)4(8,9)10;/h2H,1H3;1H4 |
| InChIKey | BNORVILOSSAGQJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |