C4H3F6NO5S2 — CID 139995086
2,2-bis(trifluoromethylsulfonyl)acetamide (PubChem CID 139995086) has the molecular formula C4H3F6NO5S2 and a molecular weight of 323.19 g/mol. Its IUPAC name is 2,2-bis(trifluoromethylsulfonyl)acetamide.
| Compound Name | 2,2-bis(trifluoromethylsulfonyl)acetamide |
|---|---|
| PubChem CID | 139995086 |
| Molecular Formula | C4H3F6NO5S2 |
| Molecular Weight | 323.19 g/mol |
| Exact Mass | 322.94 |
| IUPAC Name | 2,2-bis(trifluoromethylsulfonyl)acetamide |
| SMILES | NC(=O)C(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C4H3F6NO5S2/c5-3(6,7)17(13,14)2(1(11)12)18(15,16)4(8,9)10/h2H,(H2,11,12) |
| InChIKey | FVFDSEOEGBFUSP-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.19 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |