C4H5F3O5S — CID 90731655
3-hydroxy-2-(trifluoromethylsulfonyl)propanoic acid (PubChem CID 90731655) has the molecular formula C4H5F3O5S and a molecular weight of 222.14 g/mol. Its IUPAC name is 3-hydroxy-2-(trifluoromethylsulfonyl)propanoic acid.
| Compound Name | 3-hydroxy-2-(trifluoromethylsulfonyl)propanoic acid |
|---|---|
| PubChem CID | 90731655 |
| Molecular Formula | C4H5F3O5S |
| Molecular Weight | 222.14 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | 3-hydroxy-2-(trifluoromethylsulfonyl)propanoic acid |
| SMILES | O=C(O)C(CO)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C4H5F3O5S/c5-4(6,7)13(11,12)2(1-8)3(9)10/h2,8H,1H2,(H,9,10) |
| InChIKey | LPJBJOFSWKFOQC-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.14 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |