C10H13BrF6O6S2 — CID 88738793
4-bromo-2-ethyl-6,6-bis(trifluoromethylsulfonyl)hexanoic acid (PubChem CID 88738793) has the molecular formula C10H13BrF6O6S2 and a molecular weight of 487.23 g/mol. Its IUPAC name is 4-bromo-2-ethyl-6,6-bis(trifluoromethylsulfonyl)hexanoic acid.
| Compound Name | 4-bromo-2-ethyl-6,6-bis(trifluoromethylsulfonyl)hexanoic acid |
|---|---|
| PubChem CID | 88738793 |
| Molecular Formula | C10H13BrF6O6S2 |
| Molecular Weight | 487.23 g/mol |
| Exact Mass | 485.92 |
| IUPAC Name | 4-bromo-2-ethyl-6,6-bis(trifluoromethylsulfonyl)hexanoic acid |
| SMILES | CCC(CC(Br)CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C10H13BrF6O6S2/c1-2-5(8(18)19)3-6(11)4-7(24(20,21)9(12,13)14)25(22,23)10(15,16)17/h5-7H,2-4H2,1H3,(H,18,19) |
| InChIKey | SJVBQYSPRHIASR-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.23 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|