C7H8BrClF6O4S2 — CID 87353259
3-bromo-5-chloro-1,1-bis(trifluoromethylsulfonyl)pentane (PubChem CID 87353259) has the molecular formula C7H8BrClF6O4S2 and a molecular weight of 449.62 g/mol. Its IUPAC name is 3-bromo-5-chloro-1,1-bis(trifluoromethylsulfonyl)pentane.
| Compound Name | 3-bromo-5-chloro-1,1-bis(trifluoromethylsulfonyl)pentane |
|---|---|
| PubChem CID | 87353259 |
| Molecular Formula | C7H8BrClF6O4S2 |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 447.86 |
| IUPAC Name | 3-bromo-5-chloro-1,1-bis(trifluoromethylsulfonyl)pentane |
| SMILES | O=S(=O)(C(CC(Br)CCCl)S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H8BrClF6O4S2/c8-4(1-2-9)3-5(20(16,17)6(10,11)12)21(18,19)7(13,14)15/h4-5H,1-3H2 |
| InChIKey | PAKBQRVBRSFGGT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|