C7H10F6O4S3 — CID 126660409
4-methylsulfanyl-1,1-bis(trifluoromethylsulfonyl)butane (PubChem CID 126660409) has the molecular formula C7H10F6O4S3 and a molecular weight of 368.34 g/mol. Its IUPAC name is 4-methylsulfanyl-1,1-bis(trifluoromethylsulfonyl)butane.
| Compound Name | 4-methylsulfanyl-1,1-bis(trifluoromethylsulfonyl)butane |
|---|---|
| PubChem CID | 126660409 |
| Molecular Formula | C7H10F6O4S3 |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | 4-methylsulfanyl-1,1-bis(trifluoromethylsulfonyl)butane |
| SMILES | CSCCCC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H10F6O4S3/c1-18-4-2-3-5(19(14,15)6(8,9)10)20(16,17)7(11,12)13/h5H,2-4H2,1H3 |
| InChIKey | FLNCTRXVCXIMFC-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|