C11H14F2OS — CID 103089788
1-(2,6-difluorophenyl)-4-methylsulfanylbutan-1-ol (PubChem CID 103089788) has the molecular formula C11H14F2OS and a molecular weight of 232.29 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-4-methylsulfanylbutan-1-ol.
| Compound Name | 1-(2,6-difluorophenyl)-4-methylsulfanylbutan-1-ol |
|---|---|
| PubChem CID | 103089788 |
| Molecular Formula | C11H14F2OS |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 1-(2,6-difluorophenyl)-4-methylsulfanylbutan-1-ol |
| SMILES | CSCCCC(O)c1c(F)cccc1F |
| InChI | InChI=1S/C11H14F2OS/c1-15-7-3-6-10(14)11-8(12)4-2-5-9(11)13/h2,4-5,10,14H,3,6-7H2,1H3 |
| InChIKey | NYVRKJBLCFLUMU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|