C12H16Cl2OS — CID 103089720
1-(2,6-dichlorophenyl)-5-methylsulfanylpentan-2-ol (PubChem CID 103089720) has the molecular formula C12H16Cl2OS and a molecular weight of 279.23 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-5-methylsulfanylpentan-2-ol.
| Compound Name | 1-(2,6-dichlorophenyl)-5-methylsulfanylpentan-2-ol |
|---|---|
| PubChem CID | 103089720 |
| Molecular Formula | C12H16Cl2OS |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-5-methylsulfanylpentan-2-ol |
| SMILES | CSCCCC(O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H16Cl2OS/c1-16-7-3-4-9(15)8-10-11(13)5-2-6-12(10)14/h2,5-6,9,15H,3-4,7-8H2,1H3 |
| InChIKey | UJDXJWSTMVBJAX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|