C7H5F6NO5S2 — CID 139244927
4,4-bis(trifluoromethylsulfonyl)butanoyl cyanide (PubChem CID 139244927) has the molecular formula C7H5F6NO5S2 and a molecular weight of 361.24 g/mol. Its IUPAC name is 4,4-bis(trifluoromethylsulfonyl)butanoyl cyanide.
| Compound Name | 4,4-bis(trifluoromethylsulfonyl)butanoyl cyanide |
|---|---|
| PubChem CID | 139244927 |
| Molecular Formula | C7H5F6NO5S2 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.95 |
| IUPAC Name | 4,4-bis(trifluoromethylsulfonyl)butanoyl cyanide |
| SMILES | N#CC(=O)CCC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H5F6NO5S2/c8-6(9,10)20(16,17)5(2-1-4(15)3-14)21(18,19)7(11,12)13/h5H,1-2H2 |
| InChIKey | FVJVRTMALYGSJE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 109.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|