C13H18F6O6S2 — CID 58193508
[2-methyl-6,6-bis(trifluoromethylsulfonyl)hexan-3-yl] but-3-enoate (PubChem CID 58193508) has the molecular formula C13H18F6O6S2 and a molecular weight of 448.40 g/mol. Its IUPAC name is [2-methyl-6,6-bis(trifluoromethylsulfonyl)hexan-3-yl] but-3-enoate.
| Compound Name | [2-methyl-6,6-bis(trifluoromethylsulfonyl)hexan-3-yl] but-3-enoate |
|---|---|
| PubChem CID | 58193508 |
| Molecular Formula | C13H18F6O6S2 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | [2-methyl-6,6-bis(trifluoromethylsulfonyl)hexan-3-yl] but-3-enoate |
| SMILES | C=CCC(=O)OC(CCC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C13H18F6O6S2/c1-4-5-10(20)25-9(8(2)3)6-7-11(26(21,22)12(14,15)16)27(23,24)13(17,18)19/h4,8-9,11H,1,5-7H2,2-3H3 |
| InChIKey | MDRYKLQLLVYREA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|