C11H14F6O6S2 — CID 58193533
1,1-bis(trifluoromethylsulfonyl)pentan-3-yl but-3-enoate (PubChem CID 58193533) has the molecular formula C11H14F6O6S2 and a molecular weight of 420.35 g/mol. Its IUPAC name is 1,1-bis(trifluoromethylsulfonyl)pentan-3-yl but-3-enoate.
| Compound Name | 1,1-bis(trifluoromethylsulfonyl)pentan-3-yl but-3-enoate |
|---|---|
| PubChem CID | 58193533 |
| Molecular Formula | C11H14F6O6S2 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | 1,1-bis(trifluoromethylsulfonyl)pentan-3-yl but-3-enoate |
| SMILES | C=CCC(=O)OC(CC)CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H14F6O6S2/c1-3-5-8(18)23-7(4-2)6-9(24(19,20)10(12,13)14)25(21,22)11(15,16)17/h3,7,9H,1,4-6H2,2H3 |
| InChIKey | YOBDNXZGHZPWLE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|