C8H10F8O5S2 — CID 88964966
1-(1,1,2,2,2-pentafluoroethylsulfonyl)-1-(trifluoromethylsulfonyl)pentan-3-ol (PubChem CID 88964966) has the molecular formula C8H10F8O5S2 and a molecular weight of 402.28 g/mol. Its IUPAC name is 1-(1,1,2,2,2-pentafluoroethylsulfonyl)-1-(trifluoromethylsulfonyl)pentan-3-ol.
| Compound Name | 1-(1,1,2,2,2-pentafluoroethylsulfonyl)-1-(trifluoromethylsulfonyl)pentan-3-ol |
|---|---|
| PubChem CID | 88964966 |
| Molecular Formula | C8H10F8O5S2 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 401.98 |
| IUPAC Name | 1-(1,1,2,2,2-pentafluoroethylsulfonyl)-1-(trifluoromethylsulfonyl)pentan-3-ol |
| SMILES | CCC(O)CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H10F8O5S2/c1-2-4(17)3-5(23(20,21)8(14,15)16)22(18,19)7(12,13)6(9,10)11/h4-5,17H,2-3H2,1H3 |
| InChIKey | XATSSXHLOURQTO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|