C20H34F10NO4S2+ — CID 159665095
4,4-bis(1,1,2,2,2-pentafluoroethylsulfonyl)butyl-tributylazanium (PubChem CID 159665095) has the molecular formula C20H34F10NO4S2+ and a molecular weight of 606.61 g/mol. Its IUPAC name is 4,4-bis(1,1,2,2,2-pentafluoroethylsulfonyl)butyl-tributylazanium.
| Compound Name | 4,4-bis(1,1,2,2,2-pentafluoroethylsulfonyl)butyl-tributylazanium |
|---|---|
| PubChem CID | 159665095 |
| Molecular Formula | C20H34F10NO4S2+ |
| Molecular Weight | 606.61 g/mol |
| Exact Mass | 606.18 |
| IUPAC Name | 4,4-bis(1,1,2,2,2-pentafluoroethylsulfonyl)butyl-tributylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC(S(=O)(=O)C(F)(F)C(F)(F)F)S(=O)(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H34F10NO4S2/c1-4-7-12-31(13-8-5-2,14-9-6-3)15-10-11-16(36(32,33)19(27,28)17(21,22)23)37(34,35)20(29,30)18(24,25)26/h16H,4-15H2,1-3H3/q+1 |
| InChIKey | MTHOKONDESUBOI-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.61 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|