C17H37F3N2O2S — CID 170352651
tetrabutylazanium;trifluoromethanesulfonimidate (PubChem CID 170352651) has the molecular formula C17H37F3N2O2S and a molecular weight of 390.56 g/mol. Its IUPAC name is tetrabutylazanium;trifluoromethanesulfonimidate.
| Compound Name | tetrabutylazanium;trifluoromethanesulfonimidate |
|---|---|
| PubChem CID | 170352651 |
| Molecular Formula | C17H37F3N2O2S |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | tetrabutylazanium;trifluoromethanesulfonimidate |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.[H]N=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C16H36N.CH2F3NO2S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2-1(3,4)8(5,6)7/h5-16H2,1-4H3;(H2,5,6,7)/q+1;/p-1 |
| InChIKey | NJMDIGASXMBVMM-UHFFFAOYSA-M |
| XLogP | 5.69 |
| TPSA | 63.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|