About sulfoazanide;tetrabutylazanium
sulfoazanide;tetrabutylazanium (PubChem CID 88740579) has the molecular formula C16H38N2O3S
and a molecular weight of 338.56 g/mol. Its IUPAC name is sulfoazanide;tetrabutylazanium.
Molecular Properties
| Compound Name | sulfoazanide;tetrabutylazanium |
| PubChem CID | 88740579 |
| Molecular Formula | C16H38N2O3S |
| Molecular Weight | 338.56 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | sulfoazanide;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.[NH-]S(=O)(=O)O |
| InChI | InChI=1S/C16H36N.H2NO3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5(2,3)4/h5-16H2,1-4H3;(H2-,1,2,3,4)/q+1;-1 |
| InChIKey | BZGRKRZRJCLJCK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 78.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.56 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sulfoazanide;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfoazanide;tetrabutylazanium?
The IUPAC name of sulfoazanide;tetrabutylazanium (CID 88740579) is sulfoazanide;tetrabutylazanium.
What is the SMILES notation for sulfoazanide;tetrabutylazanium?
The canonical SMILES for sulfoazanide;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.[NH-]S(=O)(=O)O.
What is the InChIKey of sulfoazanide;tetrabutylazanium?
The InChIKey is BZGRKRZRJCLJCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N.H2NO3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5(2,3)4/h5-16H2,1-4H3;(H2-,1,2,3,4)/q+1;-1.
What are the key properties of sulfoazanide;tetrabutylazanium?
sulfoazanide;tetrabutylazanium has a molecular weight of 338.56 g/mol, XLogP of 4.84, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sulfoazanide;tetrabutylazanium is sourced from PubChem (CID 88740579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).