About potassium;hydroperoxy hydrogen sulfate;tetrabutylazanium
potassium;hydroperoxy hydrogen sulfate;tetrabutylazanium (PubChem CID 173021966) has the molecular formula C16H38KNO6S+2
and a molecular weight of 411.65 g/mol. Its IUPAC name is potassium;hydroperoxy hydrogen sulfate;tetrabutylazanium.
Molecular Properties
| Compound Name | potassium;hydroperoxy hydrogen sulfate;tetrabutylazanium |
| PubChem CID | 173021966 |
| Molecular Formula | C16H38KNO6S+2 |
| Molecular Weight | 411.65 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | potassium;hydroperoxy hydrogen sulfate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)(O)OOO.[K+] |
| InChI | InChI=1S/C16H36N.K.H2O6S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;1-5-6-7(2,3)4/h5-16H2,1-4H3;;1H,(H,2,3,4)/q2*+1; |
| InChIKey | YHYUAWCXJVBIRI-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.65 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydroperoxy hydrogen sulfate;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydroperoxy hydrogen sulfate;tetrabutylazanium?
The IUPAC name of potassium;hydroperoxy hydrogen sulfate;tetrabutylazanium (CID 173021966) is potassium;hydroperoxy hydrogen sulfate;tetrabutylazanium.
What is the SMILES notation for potassium;hydroperoxy hydrogen sulfate;tetrabutylazanium?
The canonical SMILES for potassium;hydroperoxy hydrogen sulfate;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)(O)OOO.[K+].
What is the InChIKey of potassium;hydroperoxy hydrogen sulfate;tetrabutylazanium?
The InChIKey is YHYUAWCXJVBIRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N.K.H2O6S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;1-5-6-7(2,3)4/h5-16H2,1-4H3;;1H,(H,2,3,4)/q2*+1;.
What are the key properties of potassium;hydroperoxy hydrogen sulfate;tetrabutylazanium?
potassium;hydroperoxy hydrogen sulfate;tetrabutylazanium has a molecular weight of 411.65 g/mol, XLogP of 1.22, 14 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydroperoxy hydrogen sulfate;tetrabutylazanium is sourced from PubChem (CID 173021966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).