About fluoro sulfate;tetrabutylazanium
fluoro sulfate;tetrabutylazanium (PubChem CID 87072761) has the molecular formula C16H36FNO4S
and a molecular weight of 357.53 g/mol. Its IUPAC name is fluoro sulfate;tetrabutylazanium.
Molecular Properties
| Compound Name | fluoro sulfate;tetrabutylazanium |
| PubChem CID | 87072761 |
| Molecular Formula | C16H36FNO4S |
| Molecular Weight | 357.53 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | fluoro sulfate;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)([O-])OF |
| InChI | InChI=1S/C16H36N.FHO4S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5-6(2,3)4/h5-16H2,1-4H3;(H,2,3,4)/q+1;/p-1 |
| InChIKey | PLGOFFRGWSGEED-UHFFFAOYSA-M |
| XLogP | 4.35 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze fluoro sulfate;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro sulfate;tetrabutylazanium?
The IUPAC name of fluoro sulfate;tetrabutylazanium (CID 87072761) is fluoro sulfate;tetrabutylazanium.
What is the SMILES notation for fluoro sulfate;tetrabutylazanium?
The canonical SMILES for fluoro sulfate;tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)([O-])OF.
What is the InChIKey of fluoro sulfate;tetrabutylazanium?
The InChIKey is PLGOFFRGWSGEED-UHFFFAOYSA-M. The full InChI is InChI=1S/C16H36N.FHO4S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5-6(2,3)4/h5-16H2,1-4H3;(H,2,3,4)/q+1;/p-1.
What are the key properties of fluoro sulfate;tetrabutylazanium?
fluoro sulfate;tetrabutylazanium has a molecular weight of 357.53 g/mol, XLogP of 4.35, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro sulfate;tetrabutylazanium is sourced from PubChem (CID 87072761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).