About diethyl-pentyl-propylazanium;trifluoro(trifluoromethylsulfonylsulfanylsulfonyl)methane
diethyl-pentyl-propylazanium;trifluoro(trifluoromethylsulfonylsulfanylsulfonyl)methane (PubChem CID 171929799) has the molecular formula C14H28F6NO4S3+
and a molecular weight of 484.57 g/mol. Its IUPAC name is diethyl-pentyl-propylazanium;trifluoro(trifluoromethylsulfonylsulfanylsulfonyl)methane.
Molecular Properties
| Compound Name | diethyl-pentyl-propylazanium;trifluoro(trifluoromethylsulfonylsulfanylsulfonyl)methane |
| PubChem CID | 171929799 |
| Molecular Formula | C14H28F6NO4S3+ |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | diethyl-pentyl-propylazanium;trifluoro(trifluoromethylsulfonylsulfanylsulfonyl)methane |
| SMILES | CCCCC[N+](CC)(CC)CCC.O=S(=O)(SS(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H28N.C2F6O4S3/c1-5-9-10-12-13(7-3,8-4)11-6-2;3-1(4,5)14(9,10)13-15(11,12)2(6,7)8/h5-12H2,1-4H3;/q+1; |
| InChIKey | NXMIRSNSVMXGJF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze diethyl-pentyl-propylazanium;trifluoro(trifluoromethylsulfonylsulfanylsulfonyl)methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl-pentyl-propylazanium;trifluoro(trifluoromethylsulfonylsulfanylsulfonyl)methane?
The IUPAC name of diethyl-pentyl-propylazanium;trifluoro(trifluoromethylsulfonylsulfanylsulfonyl)methane (CID 171929799) is diethyl-pentyl-propylazanium;trifluoro(trifluoromethylsulfonylsulfanylsulfonyl)methane.
What is the SMILES notation for diethyl-pentyl-propylazanium;trifluoro(trifluoromethylsulfonylsulfanylsulfonyl)methane?
The canonical SMILES for diethyl-pentyl-propylazanium;trifluoro(trifluoromethylsulfonylsulfanylsulfonyl)methane is CCCCC[N+](CC)(CC)CCC.O=S(=O)(SS(=O)(=O)C(F)(F)F)C(F)(F)F.
What is the InChIKey of diethyl-pentyl-propylazanium;trifluoro(trifluoromethylsulfonylsulfanylsulfonyl)methane?
The InChIKey is NXMIRSNSVMXGJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N.C2F6O4S3/c1-5-9-10-12-13(7-3,8-4)11-6-2;3-1(4,5)14(9,10)13-15(11,12)2(6,7)8/h5-12H2,1-4H3;/q+1;.
What are the key properties of diethyl-pentyl-propylazanium;trifluoro(trifluoromethylsulfonylsulfanylsulfonyl)methane?
diethyl-pentyl-propylazanium;trifluoro(trifluoromethylsulfonylsulfanylsulfonyl)methane has a molecular weight of 484.57 g/mol, XLogP of 4.86, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl-pentyl-propylazanium;trifluoro(trifluoromethylsulfonylsulfanylsulfonyl)methane is sourced from PubChem (CID 171929799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).