C29H57F3N2O3S — CID 22311736
1-octylpyrrole;tetrabutylazanium;trifluoromethanesulfonate (PubChem CID 22311736) has the molecular formula C29H57F3N2O3S and a molecular weight of 570.85 g/mol. Its IUPAC name is 1-octylpyrrole;tetrabutylazanium;trifluoromethanesulfonate.
| Compound Name | 1-octylpyrrole;tetrabutylazanium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22311736 |
| Molecular Formula | C29H57F3N2O3S |
| Molecular Weight | 570.85 g/mol |
| Exact Mass | 570.40 |
| IUPAC Name | 1-octylpyrrole;tetrabutylazanium;trifluoromethanesulfonate |
| SMILES | CCCCCCCCn1cccc1.CCCC[N+](CCCC)(CCCC)CCCC.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C16H36N.C12H21N.CHF3O3S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2-3-4-5-6-7-10-13-11-8-9-12-13;2-1(3,4)8(5,6)7/h5-16H2,1-4H3;8-9,11-12H,2-7,10H2,1H3;(H,5,6,7)/q+1;;/p-1 |
| InChIKey | OSNXLBCVWDPITO-UHFFFAOYSA-M |
| XLogP | 8.90 |
| TPSA | 62.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.85 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|