C22H36F18NP — CID 45268491
Tetrabutylammonium tris(pentafluoroethyl)triflrorophosphate (PubChem CID 45268491) has the molecular formula C22H36F18NP and a molecular weight of 687.47 g/mol.
| Compound Name | Tetrabutylammonium tris(pentafluoroethyl)triflrorophosphate |
|---|---|
| PubChem CID | 45268491 |
| Molecular Formula | C22H36F18NP |
| Molecular Weight | 687.47 g/mol |
| Exact Mass | 687.23 |
| IUPAC Name | — |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.FC(F)(F)C(F)(F)[P-](F)(F)(F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H36N.C6F18P/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;7-1(8,9)4(16,17)25(22,23,24,5(18,19)2(10,11)12)6(20,21)3(13,14)15/h5-16H2,1-4H3;/q+1;-1 |
| InChIKey | PWTQNCVIWOMBPP-UHFFFAOYSA-N |
| XLogP | 12.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.47 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|