About Tetrabutylammonium tris(pentafluoroethyl)triflrorophosphate
Tetrabutylammonium tris(pentafluoroethyl)triflrorophosphate (PubChem CID 45268491) has the molecular formula C22H36F18NP
and a molecular weight of 687.47 g/mol.
Molecular Properties
| Compound Name | Tetrabutylammonium tris(pentafluoroethyl)triflrorophosphate |
| PubChem CID | 45268491 |
| Molecular Formula | C22H36F18NP |
| Molecular Weight | 687.47 g/mol |
| Exact Mass | 687.23 |
| IUPAC Name | — |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.FC(F)(F)C(F)(F)[P-](F)(F)(F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H36N.C6F18P/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;7-1(8,9)4(16,17)25(22,23,24,5(18,19)2(10,11)12)6(20,21)3(13,14)15/h5-16H2,1-4H3;/q+1;-1 |
| InChIKey | PWTQNCVIWOMBPP-UHFFFAOYSA-N |
| XLogP | 12.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 687.47 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze Tetrabutylammonium tris(pentafluoroethyl)triflrorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tetrabutylammonium tris(pentafluoroethyl)triflrorophosphate?
The IUPAC name of Tetrabutylammonium tris(pentafluoroethyl)triflrorophosphate (CID 45268491) is not available.
What is the SMILES notation for Tetrabutylammonium tris(pentafluoroethyl)triflrorophosphate?
The canonical SMILES for Tetrabutylammonium tris(pentafluoroethyl)triflrorophosphate is CCCC[N+](CCCC)(CCCC)CCCC.FC(F)(F)C(F)(F)[P-](F)(F)(F)(C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F.
What is the InChIKey of Tetrabutylammonium tris(pentafluoroethyl)triflrorophosphate?
The InChIKey is PWTQNCVIWOMBPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N.C6F18P/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;7-1(8,9)4(16,17)25(22,23,24,5(18,19)2(10,11)12)6(20,21)3(13,14)15/h5-16H2,1-4H3;/q+1;-1.
What are the key properties of Tetrabutylammonium tris(pentafluoroethyl)triflrorophosphate?
Tetrabutylammonium tris(pentafluoroethyl)triflrorophosphate has a molecular weight of 687.47 g/mol, XLogP of 12.20, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Tetrabutylammonium tris(pentafluoroethyl)triflrorophosphate is sourced from PubChem (CID 45268491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).