About tetrapentylazanium hexafluorophosphate
tetrapentylazanium hexafluorophosphate (PubChem CID 135309206) has the molecular formula C20H44F6NP
and a molecular weight of 443.54 g/mol. Its IUPAC name is tetrapentylazanium hexafluorophosphate.
Molecular Properties
| Compound Name | tetrapentylazanium hexafluorophosphate |
| PubChem CID | 135309206 |
| Molecular Formula | C20H44F6NP |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.31 |
| IUPAC Name | tetrapentylazanium hexafluorophosphate |
| SMILES | CCCCC[N+](CCCCC)(CCCCC)CCCCC.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C20H44N.F6P/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;1-7(2,3,4,5)6/h5-20H2,1-4H3;/q+1;-1 |
| InChIKey | UFMSMWLZNSCHEU-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetrapentylazanium hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrapentylazanium hexafluorophosphate?
The IUPAC name of tetrapentylazanium hexafluorophosphate (CID 135309206) is tetrapentylazanium hexafluorophosphate.
What is the SMILES notation for tetrapentylazanium hexafluorophosphate?
The canonical SMILES for tetrapentylazanium hexafluorophosphate is CCCCC[N+](CCCCC)(CCCCC)CCCCC.F[P-](F)(F)(F)(F)F.
What is the InChIKey of tetrapentylazanium hexafluorophosphate?
The InChIKey is UFMSMWLZNSCHEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H44N.F6P/c1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;1-7(2,3,4,5)6/h5-20H2,1-4H3;/q+1;-1.
What are the key properties of tetrapentylazanium hexafluorophosphate?
tetrapentylazanium hexafluorophosphate has a molecular weight of 443.54 g/mol, XLogP of 9.95, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrapentylazanium hexafluorophosphate is sourced from PubChem (CID 135309206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).