About hydron;tetrabutylazanium;sulfide
hydron;tetrabutylazanium;sulfide (PubChem CID 87064104) has the molecular formula C16H37NS
and a molecular weight of 275.55 g/mol. Its IUPAC name is hydron;tetrabutylazanium;sulfide.
Molecular Properties
| Compound Name | hydron;tetrabutylazanium;sulfide |
| PubChem CID | 87064104 |
| Molecular Formula | C16H37NS |
| Molecular Weight | 275.55 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | hydron;tetrabutylazanium;sulfide |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.[H+].[S-2] |
| InChI | InChI=1S/C16H36N.S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;/q+1;-2/p+1 |
| InChIKey | GICJWOGPBLLCRO-UHFFFAOYSA-O |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze hydron;tetrabutylazanium;sulfide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;tetrabutylazanium;sulfide?
The IUPAC name of hydron;tetrabutylazanium;sulfide (CID 87064104) is hydron;tetrabutylazanium;sulfide.
What is the SMILES notation for hydron;tetrabutylazanium;sulfide?
The canonical SMILES for hydron;tetrabutylazanium;sulfide is CCCC[N+](CCCC)(CCCC)CCCC.[H+].[S-2].
What is the InChIKey of hydron;tetrabutylazanium;sulfide?
The InChIKey is GICJWOGPBLLCRO-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H36N.S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;/q+1;-2/p+1.
What are the key properties of hydron;tetrabutylazanium;sulfide?
hydron;tetrabutylazanium;sulfide has a molecular weight of 275.55 g/mol, XLogP of 5.11, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;tetrabutylazanium;sulfide is sourced from PubChem (CID 87064104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).