About hydron;tetrabutylazanium;hydrobromide
hydron;tetrabutylazanium;hydrobromide (PubChem CID 173127393) has the molecular formula C16H38BrN+2
and a molecular weight of 324.39 g/mol. Its IUPAC name is hydron;tetrabutylazanium;hydrobromide.
Molecular Properties
| Compound Name | hydron;tetrabutylazanium;hydrobromide |
| PubChem CID | 173127393 |
| Molecular Formula | C16H38BrN+2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | hydron;tetrabutylazanium;hydrobromide |
| SMILES | Br.CCCC[N+](CCCC)(CCCC)CCCC.[H+] |
| InChI | InChI=1S/C16H36N.BrH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p+1 |
| InChIKey | JRMUNVKIHCOMHV-UHFFFAOYSA-O |
| XLogP | 5.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze hydron;tetrabutylazanium;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;tetrabutylazanium;hydrobromide?
The IUPAC name of hydron;tetrabutylazanium;hydrobromide (CID 173127393) is hydron;tetrabutylazanium;hydrobromide.
What is the SMILES notation for hydron;tetrabutylazanium;hydrobromide?
The canonical SMILES for hydron;tetrabutylazanium;hydrobromide is Br.CCCC[N+](CCCC)(CCCC)CCCC.[H+].
What is the InChIKey of hydron;tetrabutylazanium;hydrobromide?
The InChIKey is JRMUNVKIHCOMHV-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H36N.BrH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p+1.
What are the key properties of hydron;tetrabutylazanium;hydrobromide?
hydron;tetrabutylazanium;hydrobromide has a molecular weight of 324.39 g/mol, XLogP of 5.69, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;tetrabutylazanium;hydrobromide is sourced from PubChem (CID 173127393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).