About tetrabutylazanium;hydrobromide;hydrochloride
tetrabutylazanium;hydrobromide;hydrochloride (PubChem CID 174732596) has the molecular formula C16H38BrClN+
and a molecular weight of 359.84 g/mol. Its IUPAC name is tetrabutylazanium;hydrobromide;hydrochloride.
Molecular Properties
| Compound Name | tetrabutylazanium;hydrobromide;hydrochloride |
| PubChem CID | 174732596 |
| Molecular Formula | C16H38BrClN+ |
| Molecular Weight | 359.84 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | tetrabutylazanium;hydrobromide;hydrochloride |
| SMILES | Br.CCCC[N+](CCCC)(CCCC)CCCC.Cl |
| InChI | InChI=1S/C16H36N.BrH.ClH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;/h5-16H2,1-4H3;2*1H/q+1;; |
| InChIKey | SJDXDQQSKGKRLJ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.84 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetrabutylazanium;hydrobromide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrabutylazanium;hydrobromide;hydrochloride?
The IUPAC name of tetrabutylazanium;hydrobromide;hydrochloride (CID 174732596) is tetrabutylazanium;hydrobromide;hydrochloride.
What is the SMILES notation for tetrabutylazanium;hydrobromide;hydrochloride?
The canonical SMILES for tetrabutylazanium;hydrobromide;hydrochloride is Br.CCCC[N+](CCCC)(CCCC)CCCC.Cl.
What is the InChIKey of tetrabutylazanium;hydrobromide;hydrochloride?
The InChIKey is SJDXDQQSKGKRLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N.BrH.ClH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;;/h5-16H2,1-4H3;2*1H/q+1;;.
What are the key properties of tetrabutylazanium;hydrobromide;hydrochloride?
tetrabutylazanium;hydrobromide;hydrochloride has a molecular weight of 359.84 g/mol, XLogP of 6.00, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetrabutylazanium;hydrobromide;hydrochloride is sourced from PubChem (CID 174732596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).