About tetraheptylazanium;hydrobromide;hydrochloride
tetraheptylazanium;hydrobromide;hydrochloride (PubChem CID 175577779) has the molecular formula C28H62BrClN+
and a molecular weight of 528.17 g/mol. Its IUPAC name is tetraheptylazanium;hydrobromide;hydrochloride.
Molecular Properties
| Compound Name | tetraheptylazanium;hydrobromide;hydrochloride |
| PubChem CID | 175577779 |
| Molecular Formula | C28H62BrClN+ |
| Molecular Weight | 528.17 g/mol |
| Exact Mass | 526.37 |
| IUPAC Name | tetraheptylazanium;hydrobromide;hydrochloride |
| SMILES | Br.CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC.Cl |
| InChI | InChI=1S/C28H60N.BrH.ClH/c1-5-9-13-17-21-25-29(26-22-18-14-10-6-2,27-23-19-15-11-7-3)28-24-20-16-12-8-4;;/h5-28H2,1-4H3;2*1H/q+1;; |
| InChIKey | XIYLTPSTQOWVRR-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 24 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 528.17 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tetraheptylazanium;hydrobromide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetraheptylazanium;hydrobromide;hydrochloride?
The IUPAC name of tetraheptylazanium;hydrobromide;hydrochloride (CID 175577779) is tetraheptylazanium;hydrobromide;hydrochloride.
What is the SMILES notation for tetraheptylazanium;hydrobromide;hydrochloride?
The canonical SMILES for tetraheptylazanium;hydrobromide;hydrochloride is Br.CCCCCCC[N+](CCCCCCC)(CCCCCCC)CCCCCCC.Cl.
What is the InChIKey of tetraheptylazanium;hydrobromide;hydrochloride?
The InChIKey is XIYLTPSTQOWVRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H60N.BrH.ClH/c1-5-9-13-17-21-25-29(26-22-18-14-10-6-2,27-23-19-15-11-7-3)28-24-20-16-12-8-4;;/h5-28H2,1-4H3;2*1H/q+1;;.
What are the key properties of tetraheptylazanium;hydrobromide;hydrochloride?
tetraheptylazanium;hydrobromide;hydrochloride has a molecular weight of 528.17 g/mol, XLogP of 10.68, 24 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tetraheptylazanium;hydrobromide;hydrochloride is sourced from PubChem (CID 175577779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).